C25H28ClN5O3 — CID 58716971
[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone (PubChem CID 58716971) has the molecular formula C25H28ClN5O3 and a molecular weight of 481.98 g/mol. Its IUPAC name is [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone.
| Compound Name | [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 58716971 |
| Molecular Formula | C25H28ClN5O3 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Nc2nccc(-c3ccc(Cl)cc3)n2)cc1)N1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C25H28ClN5O3/c26-21-5-1-19(2-6-21)23-9-10-27-25(29-23)28-22-7-3-20(4-8-22)24(33)31-13-11-30(12-14-31)15-17-34-18-16-32/h1-10,32H,11-18H2,(H,27,28,29) |
| InChIKey | NVXCKBCMNIUWIF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|