C27H30ClN5O3 — CID 142946198
2-butoxy-1-[4-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone (PubChem CID 142946198) has the molecular formula C27H30ClN5O3 and a molecular weight of 508.02 g/mol. Its IUPAC name is 2-butoxy-1-[4-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 2-butoxy-1-[4-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142946198 |
| Molecular Formula | C27H30ClN5O3 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-butoxy-1-[4-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone |
| SMILES | CCCCOCC(=O)N1CCN(C(=O)c2ccc(Nc3nccc(-c4ccc(Cl)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H30ClN5O3/c1-2-3-18-36-19-25(34)32-14-16-33(17-15-32)26(35)21-6-10-23(11-7-21)30-27-29-13-12-24(31-27)20-4-8-22(28)9-5-20/h4-13H,2-3,14-19H2,1H3,(H,29,30,31) |
| InChIKey | NEQVTIOILJCDKA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|