C29H35N5O2S — CID 58721811
1-[4-[4-[[4-(4-hexylsulfanylphenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone (PubChem CID 58721811) has the molecular formula C29H35N5O2S and a molecular weight of 517.70 g/mol. Its IUPAC name is 1-[4-[4-[[4-(4-hexylsulfanylphenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[4-(4-hexylsulfanylphenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58721811 |
| Molecular Formula | C29H35N5O2S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 1-[4-[4-[[4-(4-hexylsulfanylphenyl)pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]ethanone |
| SMILES | CCCCCCSc1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(C)=O)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H35N5O2S/c1-3-4-5-6-21-37-26-13-9-23(10-14-26)27-15-16-30-29(32-27)31-25-11-7-24(8-12-25)28(36)34-19-17-33(18-20-34)22(2)35/h7-16H,3-6,17-21H2,1-2H3,(H,30,31,32) |
| InChIKey | GFOXWKLRAMLZKU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|