C21H22N4OS — CID 142145636
4-[[4-(4-butylsulfanylphenyl)pyrimidin-2-yl]amino]benzamide (PubChem CID 142145636) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-[[4-(4-butylsulfanylphenyl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-(4-butylsulfanylphenyl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 142145636 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-[[4-(4-butylsulfanylphenyl)pyrimidin-2-yl]amino]benzamide |
| SMILES | CCCCSc1ccc(-c2ccnc(Nc3ccc(C(N)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H22N4OS/c1-2-3-14-27-18-10-6-15(7-11-18)19-12-13-23-21(25-19)24-17-8-4-16(5-9-17)20(22)26/h4-13H,2-3,14H2,1H3,(H2,22,26)(H,23,24,25) |
| InChIKey | NUYADAOMCFMZNF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|