C25H30N6O2S — CID 142145504
[4-[[4-[4-(3-amino-3-hydroxybutyl)sulfanylphenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone (PubChem CID 142145504) has the molecular formula C25H30N6O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is [4-[[4-[4-(3-amino-3-hydroxybutyl)sulfanylphenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[[4-[4-(3-amino-3-hydroxybutyl)sulfanylphenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 142145504 |
| Molecular Formula | C25H30N6O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [4-[[4-[4-(3-amino-3-hydroxybutyl)sulfanylphenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone |
| SMILES | CC(N)(O)CCSc1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCNCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H30N6O2S/c1-25(26,33)11-17-34-21-8-4-18(5-9-21)22-10-12-28-24(30-22)29-20-6-2-19(3-7-20)23(32)31-15-13-27-14-16-31/h2-10,12,27,33H,11,13-17,26H2,1H3,(H,28,29,30) |
| InChIKey | BOQSSPAMPDETAQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|