C26H34ClFN5OP — CID 142946364
chloromethane;ethane;[4-[[4-[4-(1-fluoro-1-phosphanylethyl)phenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone (PubChem CID 142946364) has the molecular formula C26H34ClFN5OP and a molecular weight of 518.02 g/mol. Its IUPAC name is chloromethane;ethane;[4-[[4-[4-(1-fluoro-1-phosphanylethyl)phenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone.
| Compound Name | chloromethane;ethane;[4-[[4-[4-(1-fluoro-1-phosphanylethyl)phenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 142946364 |
| Molecular Formula | C26H34ClFN5OP |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | chloromethane;ethane;[4-[[4-[4-(1-fluoro-1-phosphanylethyl)phenyl]pyrimidin-2-yl]amino]phenyl]-piperazin-1-ylmethanone |
| SMILES | CC.CC(F)(P)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCNCC4)cc3)n2)cc1.CCl |
| InChI | InChI=1S/C23H25FN5OP.C2H6.CH3Cl/c1-23(24,31)18-6-2-16(3-7-18)20-10-11-26-22(28-20)27-19-8-4-17(5-9-19)21(30)29-14-12-25-13-15-29;2*1-2/h2-11,25H,12-15,31H2,1H3,(H,26,27,28);1-2H3;1H3 |
| InChIKey | PJZWIMGSQBMEMR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|