C29H36N6O4S — CID 58716750
[4-(2-ethoxyethyl)piperazin-1-yl]-[4-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-2-yl]amino]phenyl]methanone (PubChem CID 58716750) has the molecular formula C29H36N6O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is [4-(2-ethoxyethyl)piperazin-1-yl]-[4-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-2-yl]amino]phenyl]methanone.
| Compound Name | [4-(2-ethoxyethyl)piperazin-1-yl]-[4-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-2-yl]amino]phenyl]methanone |
|---|---|
| PubChem CID | 58716750 |
| Molecular Formula | C29H36N6O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | [4-(2-ethoxyethyl)piperazin-1-yl]-[4-[[4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-2-yl]amino]phenyl]methanone |
| SMILES | CCOCCN1CCN(C(=O)c2ccc(Nc3nccc(-c4ccc(S(=O)(=O)N5CCCC5)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H36N6O4S/c1-2-39-22-21-33-17-19-34(20-18-33)28(36)24-5-9-25(10-6-24)31-29-30-14-13-27(32-29)23-7-11-26(12-8-23)40(37,38)35-15-3-4-16-35/h5-14H,2-4,15-22H2,1H3,(H,30,31,32) |
| InChIKey | UBSCHFASMAGGPM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|