C11H14N5O4P — CID 139686414
2-[[4-(2-aminopyrimidin-4-yl)-2-pyridinyl]amino]ethyl dihydrogen phosphate (PubChem CID 139686414) has the molecular formula C11H14N5O4P and a molecular weight of 311.24 g/mol. Its IUPAC name is 2-[[4-(2-aminopyrimidin-4-yl)-2-pyridinyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[[4-(2-aminopyrimidin-4-yl)-2-pyridinyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 139686414 |
| Molecular Formula | C11H14N5O4P |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-[[4-(2-aminopyrimidin-4-yl)-2-pyridinyl]amino]ethyl dihydrogen phosphate |
| SMILES | Nc1nccc(-c2ccnc(NCCOP(=O)(O)O)c2)n1 |
| InChI | InChI=1S/C11H14N5O4P/c12-11-15-4-2-9(16-11)8-1-3-13-10(7-8)14-5-6-20-21(17,18)19/h1-4,7H,5-6H2,(H,13,14)(H2,12,15,16)(H2,17,18,19) |
| InChIKey | UOEZVYJFBDZLED-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|