C18H17N5O2 — CID 168929213
methyl N-[4-[2-(5-amino-2-methylphenyl)pyrimidin-4-yl]-2-pyridinyl]carbamate (PubChem CID 168929213) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is methyl N-[4-[2-(5-amino-2-methylphenyl)pyrimidin-4-yl]-2-pyridinyl]carbamate.
| Compound Name | methyl N-[4-[2-(5-amino-2-methylphenyl)pyrimidin-4-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 168929213 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl N-[4-[2-(5-amino-2-methylphenyl)pyrimidin-4-yl]-2-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1cc(-c2ccnc(-c3cc(N)ccc3C)n2)ccn1 |
| InChI | InChI=1S/C18H17N5O2/c1-11-3-4-13(19)10-14(11)17-21-8-6-15(22-17)12-5-7-20-16(9-12)23-18(24)25-2/h3-10H,19H2,1-2H3,(H,20,23,24) |
| InChIKey | YKFDHKVOOTWYCX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|