C21H18Cl3N5O4 — CID 168928456
2,2,2-trichloroethyl N-[3-[2-[2-(methoxycarbonylamino)-4-pyridinyl]pyrimidin-4-yl]-4-methylphenyl]carbamate (PubChem CID 168928456) has the molecular formula C21H18Cl3N5O4 and a molecular weight of 510.77 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-[2-[2-(methoxycarbonylamino)-4-pyridinyl]pyrimidin-4-yl]-4-methylphenyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-[2-[2-(methoxycarbonylamino)-4-pyridinyl]pyrimidin-4-yl]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 168928456 |
| Molecular Formula | C21H18Cl3N5O4 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-[2-[2-(methoxycarbonylamino)-4-pyridinyl]pyrimidin-4-yl]-4-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1cc(-c2nccc(-c3cc(NC(=O)OCC(Cl)(Cl)Cl)ccc3C)n2)ccn1 |
| InChI | InChI=1S/C21H18Cl3N5O4/c1-12-3-4-14(27-20(31)33-11-21(22,23)24)10-15(12)16-6-8-26-18(28-16)13-5-7-25-17(9-13)29-19(30)32-2/h3-10H,11H2,1-2H3,(H,27,31)(H,25,29,30) |
| InChIKey | MKEMYIWQQCQCNN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|