C19H17Cl3N6O2 — CID 168928631
2,2,2-trichloroethyl N-[6-methyl-5-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]carbamate (PubChem CID 168928631) has the molecular formula C19H17Cl3N6O2 and a molecular weight of 467.74 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[6-methyl-5-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[6-methyl-5-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 168928631 |
| Molecular Formula | C19H17Cl3N6O2 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 2,2,2-trichloroethyl N-[6-methyl-5-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]carbamate |
| SMILES | CNc1cc(-c2ccnc(-c3cc(NC(=O)OCC(Cl)(Cl)Cl)cnc3C)n2)ccn1 |
| InChI | InChI=1S/C19H17Cl3N6O2/c1-11-14(8-13(9-26-11)27-18(29)30-10-19(20,21)22)17-25-6-4-15(28-17)12-3-5-24-16(7-12)23-2/h3-9H,10H2,1-2H3,(H,23,24)(H,27,29) |
| InChIKey | IOLUMLHQEQFFRW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|