C18H17Cl3N6 — CID 168928871
6-methyl-5-[2-[2-(methylamino)-4-pyridinyl]pyrimidin-4-yl]-N-(2,2,2-trichloroethyl)pyridin-3-amine (PubChem CID 168928871) has the molecular formula C18H17Cl3N6 and a molecular weight of 423.74 g/mol. Its IUPAC name is 6-methyl-5-[2-[2-(methylamino)-4-pyridinyl]pyrimidin-4-yl]-N-(2,2,2-trichloroethyl)pyridin-3-amine.
| Compound Name | 6-methyl-5-[2-[2-(methylamino)-4-pyridinyl]pyrimidin-4-yl]-N-(2,2,2-trichloroethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 168928871 |
| Molecular Formula | C18H17Cl3N6 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 6-methyl-5-[2-[2-(methylamino)-4-pyridinyl]pyrimidin-4-yl]-N-(2,2,2-trichloroethyl)pyridin-3-amine |
| SMILES | CNc1cc(-c2nccc(-c3cc(NCC(Cl)(Cl)Cl)cnc3C)n2)ccn1 |
| InChI | InChI=1S/C18H17Cl3N6/c1-11-14(8-13(9-25-11)26-10-18(19,20)21)15-4-6-24-17(27-15)12-3-5-23-16(7-12)22-2/h3-9,26H,10H2,1-2H3,(H,22,23) |
| InChIKey | PLFOPDATHMMEAT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|