C13H12FN3O2 — CID 166473361
methyl N-[4-(5-fluoro-6-methyl-2-pyridinyl)-2-pyridinyl]carbamate (PubChem CID 166473361) has the molecular formula C13H12FN3O2 and a molecular weight of 261.26 g/mol. Its IUPAC name is methyl N-[4-(5-fluoro-6-methyl-2-pyridinyl)-2-pyridinyl]carbamate.
| Compound Name | methyl N-[4-(5-fluoro-6-methyl-2-pyridinyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 166473361 |
| Molecular Formula | C13H12FN3O2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | methyl N-[4-(5-fluoro-6-methyl-2-pyridinyl)-2-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1cc(-c2ccc(F)c(C)n2)ccn1 |
| InChI | InChI=1S/C13H12FN3O2/c1-8-10(14)3-4-11(16-8)9-5-6-15-12(7-9)17-13(18)19-2/h3-7H,1-2H3,(H,15,17,18) |
| InChIKey | CFWABASNWYHWKU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |