C25H27N7O — CID 168929307
(Z,2E)-4-amino-2-(aminomethylidene)-4-cyclopropyl-N-[4-methyl-3-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]phenyl]but-3-enamide (PubChem CID 168929307) has the molecular formula C25H27N7O and a molecular weight of 441.54 g/mol. Its IUPAC name is (Z,2E)-4-amino-2-(aminomethylidene)-4-cyclopropyl-N-[4-methyl-3-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]phenyl]but-3-enamide.
| Compound Name | (Z,2E)-4-amino-2-(aminomethylidene)-4-cyclopropyl-N-[4-methyl-3-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]phenyl]but-3-enamide |
|---|---|
| PubChem CID | 168929307 |
| Molecular Formula | C25H27N7O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (Z,2E)-4-amino-2-(aminomethylidene)-4-cyclopropyl-N-[4-methyl-3-[4-[2-(methylamino)-4-pyridinyl]pyrimidin-2-yl]phenyl]but-3-enamide |
| SMILES | CNc1cc(-c2ccnc(-c3cc(NC(=O)C(/C=C(\N)C4CC4)=C/N)ccc3C)n2)ccn1 |
| InChI | InChI=1S/C25H27N7O/c1-15-3-6-19(31-25(33)18(14-26)11-21(27)16-4-5-16)13-20(15)24-30-10-8-22(32-24)17-7-9-29-23(12-17)28-2/h3,6-14,16H,4-5,26-27H2,1-2H3,(H,28,29)(H,31,33)/b18-14+,21-11- |
| InChIKey | UZCPNGGHGSXYJS-ZVAIREDMSA-N |
| XLogP | 3.59 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|