C30H28F3N5O3 — CID 168929359
N-[4-[4-[5-[[(E,2E)-5,5-difluoro-2-[(2Z)-2-fluoroiminoethylidene]pent-3-enoyl]amino]-2-methylphenyl]-6-ethoxy-2-pyridinyl]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 168929359) has the molecular formula C30H28F3N5O3 and a molecular weight of 563.58 g/mol. Its IUPAC name is N-[4-[4-[5-[[(E,2E)-5,5-difluoro-2-[(2Z)-2-fluoroiminoethylidene]pent-3-enoyl]amino]-2-methylphenyl]-6-ethoxy-2-pyridinyl]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[4-[5-[[(E,2E)-5,5-difluoro-2-[(2Z)-2-fluoroiminoethylidene]pent-3-enoyl]amino]-2-methylphenyl]-6-ethoxy-2-pyridinyl]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 168929359 |
| Molecular Formula | C30H28F3N5O3 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-[4-[4-[5-[[(E,2E)-5,5-difluoro-2-[(2Z)-2-fluoroiminoethylidene]pent-3-enoyl]amino]-2-methylphenyl]-6-ethoxy-2-pyridinyl]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | CCOc1cc(-c2cc(NC(=O)C(/C=C/C(F)F)=C/C=N\F)ccc2C)cc(-c2ccnc(NC(=O)C3CC3)c2)n1 |
| InChI | InChI=1S/C30H28F3N5O3/c1-3-41-28-16-22(14-25(37-28)21-10-12-34-27(15-21)38-30(40)19-5-6-19)24-17-23(8-4-18(24)2)36-29(39)20(11-13-35-33)7-9-26(31)32/h4,7-17,19,26H,3,5-6H2,1-2H3,(H,36,39)(H,34,38,40)/b9-7+,20-11+,35-13- |
| InChIKey | SPGVARKXQMZWDT-UGUCOTHCSA-N |
| XLogP | 6.51 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|