C21H22N4O2S — CID 169024748
N-[4-[4-(5-amino-2-methylphenyl)-6-cyclopropyl-2-pyridinyl]-2-pyridinyl]methanesulfonamide (PubChem CID 169024748) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[4-[4-(5-amino-2-methylphenyl)-6-cyclopropyl-2-pyridinyl]-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[4-[4-(5-amino-2-methylphenyl)-6-cyclopropyl-2-pyridinyl]-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 169024748 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[4-[4-(5-amino-2-methylphenyl)-6-cyclopropyl-2-pyridinyl]-2-pyridinyl]methanesulfonamide |
| SMILES | Cc1ccc(N)cc1-c1cc(-c2ccnc(NS(C)(=O)=O)c2)nc(C2CC2)c1 |
| InChI | InChI=1S/C21H22N4O2S/c1-13-3-6-17(22)12-18(13)16-9-19(14-4-5-14)24-20(10-16)15-7-8-23-21(11-15)25-28(2,26)27/h3,6-12,14H,4-5,22H2,1-2H3,(H,23,25) |
| InChIKey | YAEQDFJEHXVTDZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|