C21H20N4O — CID 168928933
4-[4-(5-amino-2-methylphenyl)-2-pyridinyl]-N-cyclopropylpyridine-2-carboxamide (PubChem CID 168928933) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[4-(5-amino-2-methylphenyl)-2-pyridinyl]-N-cyclopropylpyridine-2-carboxamide.
| Compound Name | 4-[4-(5-amino-2-methylphenyl)-2-pyridinyl]-N-cyclopropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 168928933 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-[4-(5-amino-2-methylphenyl)-2-pyridinyl]-N-cyclopropylpyridine-2-carboxamide |
| SMILES | Cc1ccc(N)cc1-c1ccnc(-c2ccnc(C(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C21H20N4O/c1-13-2-3-16(22)12-18(13)14-6-8-23-19(10-14)15-7-9-24-20(11-15)21(26)25-17-4-5-17/h2-3,6-12,17H,4-5,22H2,1H3,(H,25,26) |
| InChIKey | DBRPPEOGZDIXIH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|