C27H25N7O — CID 176565447
4-[4-[5-[[amino-(5-cyclopropylpyridazin-3-yl)methylidene]amino]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide (PubChem CID 176565447) has the molecular formula C27H25N7O and a molecular weight of 463.55 g/mol. Its IUPAC name is 4-[4-[5-[[amino-(5-cyclopropylpyridazin-3-yl)methylidene]amino]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[5-[[amino-(5-cyclopropylpyridazin-3-yl)methylidene]amino]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176565447 |
| Molecular Formula | C27H25N7O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 4-[4-[5-[[amino-(5-cyclopropylpyridazin-3-yl)methylidene]amino]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(-c2cc(-c3cc(/N=C(\N)c4cc(C5CC5)cnn4)ccc3C)ccn2)ccn1 |
| InChI | InChI=1S/C27H25N7O/c1-16-3-6-21(33-26(28)24-13-20(15-32-34-24)17-4-5-17)14-22(16)18-7-9-30-23(11-18)19-8-10-31-25(12-19)27(35)29-2/h3,6-15,17H,4-5H2,1-2H3,(H2,28,33)(H,29,35) |
| InChIKey | XUGLAQPTMXMWCC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|