C26H26FN5O — CID 168930656
4-[4-[5-[(E)-3-(2-fluoro-2-methylpropanimidoyl)iminoprop-1-enyl]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide (PubChem CID 168930656) has the molecular formula C26H26FN5O and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-[4-[5-[(E)-3-(2-fluoro-2-methylpropanimidoyl)iminoprop-1-enyl]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[5-[(E)-3-(2-fluoro-2-methylpropanimidoyl)iminoprop-1-enyl]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 168930656 |
| Molecular Formula | C26H26FN5O |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-[4-[5-[(E)-3-(2-fluoro-2-methylpropanimidoyl)iminoprop-1-enyl]-2-methylphenyl]-2-pyridinyl]-N-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(/N=C/C=C/c1ccc(C)c(-c2ccnc(-c3ccnc(C(=O)NC)c3)c2)c1)C(C)(C)F |
| InChI | InChI=1S/C26H26FN5O/c1-17-7-8-18(6-5-11-32-25(28)26(2,3)27)14-21(17)19-9-12-30-22(15-19)20-10-13-31-23(16-20)24(33)29-4/h5-16,28H,1-4H3,(H,29,33)/b6-5+,28-25+,32-11+ |
| InChIKey | YDMGKHSUQPEKCM-KXWUXODBSA-N |
| XLogP | 5.29 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|