C15H14N6O2S — CID 145071787
N-[4-[2-(pyrazin-2-ylamino)-4-pyridinyl]-2-pyridinyl]methanesulfonamide (PubChem CID 145071787) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-[4-[2-(pyrazin-2-ylamino)-4-pyridinyl]-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[4-[2-(pyrazin-2-ylamino)-4-pyridinyl]-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 145071787 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[4-[2-(pyrazin-2-ylamino)-4-pyridinyl]-2-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(-c2ccnc(Nc3cnccn3)c2)ccn1 |
| InChI | InChI=1S/C15H14N6O2S/c1-24(22,23)21-14-9-12(3-5-18-14)11-2-4-17-13(8-11)20-15-10-16-6-7-19-15/h2-10H,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | GZQYCFHHLLSTRG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |