C11H18N2O2S — CID 129191304
N-[4-(2,2-dimethylpropyl)-2-pyridinyl]methanesulfonamide (PubChem CID 129191304) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is N-[4-(2,2-dimethylpropyl)-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[4-(2,2-dimethylpropyl)-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 129191304 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-[4-(2,2-dimethylpropyl)-2-pyridinyl]methanesulfonamide |
| SMILES | CC(C)(C)Cc1ccnc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H18N2O2S/c1-11(2,3)8-9-5-6-12-10(7-9)13-16(4,14)15/h5-7H,8H2,1-4H3,(H,12,13) |
| InChIKey | HUTPENBCFXKQHY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |