C19H23F3N4O3S — CID 141097531
N-[4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]methanesulfonamide (PubChem CID 141097531) has the molecular formula C19H23F3N4O3S and a molecular weight of 444.48 g/mol. Its IUPAC name is N-[4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 141097531 |
| Molecular Formula | C19H23F3N4O3S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]methanesulfonamide |
| SMILES | CC1(C)CN(c2ccc(OC(F)(F)F)cc2)CN1Cc1ccnc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H23F3N4O3S/c1-18(2)12-25(15-4-6-16(7-5-15)29-19(20,21)22)13-26(18)11-14-8-9-23-17(10-14)24-30(3,27)28/h4-10H,11-13H2,1-3H3,(H,23,24) |
| InChIKey | MUCJYFSXHDVDBW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|