C25H25F3N4O2 — CID 141097158
4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-N-phenylpyridine-3-carboxamide (PubChem CID 141097158) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is 4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-N-phenylpyridine-3-carboxamide.
| Compound Name | 4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-N-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 141097158 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[[5,5-dimethyl-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]methyl]-N-phenylpyridine-3-carboxamide |
| SMILES | CC1(C)CN(c2ccc(OC(F)(F)F)cc2)CN1Cc1ccncc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H25F3N4O2/c1-24(2)16-31(20-8-10-21(11-9-20)34-25(26,27)28)17-32(24)15-18-12-13-29-14-22(18)23(33)30-19-6-4-3-5-7-19/h3-14H,15-17H2,1-2H3,(H,30,33) |
| InChIKey | LENPMQBALBIVKN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|