C19H20ClN5S — CID 67389770
4-[2-(3-chloroanilino)-4-pyridinyl]-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine (PubChem CID 67389770) has the molecular formula C19H20ClN5S and a molecular weight of 385.92 g/mol. Its IUPAC name is 4-[2-(3-chloroanilino)-4-pyridinyl]-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-[2-(3-chloroanilino)-4-pyridinyl]-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 67389770 |
| Molecular Formula | C19H20ClN5S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[2-(3-chloroanilino)-4-pyridinyl]-N-(1-methylsulfanylpropan-2-yl)pyrimidin-2-amine |
| SMILES | CSCC(C)Nc1nccc(-c2ccnc(Nc3cccc(Cl)c3)c2)n1 |
| InChI | InChI=1S/C19H20ClN5S/c1-13(12-26-2)23-19-22-9-7-17(25-19)14-6-8-21-18(10-14)24-16-5-3-4-15(20)11-16/h3-11,13H,12H2,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | HDFREQVBHPDJKB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |