C21H22N4O3 — CID 91284249
1-[2-(3,5-dimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-6-ol (PubChem CID 91284249) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-6-ol.
| Compound Name | 1-[2-(3,5-dimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-6-ol |
|---|---|
| PubChem CID | 91284249 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-[2-(3,5-dimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-6-ol |
| SMILES | COc1cc(Nc2nccc(N3CCCc4cc(O)ccc43)n2)cc(OC)c1 |
| InChI | InChI=1S/C21H22N4O3/c1-27-17-11-15(12-18(13-17)28-2)23-21-22-8-7-20(24-21)25-9-3-4-14-10-16(26)5-6-19(14)25/h5-8,10-13,26H,3-4,9H2,1-2H3,(H,22,23,24) |
| InChIKey | WSPCXRMKAATSHD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |