C19H17ClN4O — CID 56969109
1-[2-(3-chloroanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-5-ol (PubChem CID 56969109) has the molecular formula C19H17ClN4O and a molecular weight of 352.83 g/mol. Its IUPAC name is 1-[2-(3-chloroanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-5-ol.
| Compound Name | 1-[2-(3-chloroanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-5-ol |
|---|---|
| PubChem CID | 56969109 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[2-(3-chloroanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-5-ol |
| SMILES | Oc1cccc2c1CCCN2c1ccnc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H17ClN4O/c20-13-4-1-5-14(12-13)22-19-21-10-9-18(23-19)24-11-3-6-15-16(24)7-2-8-17(15)25/h1-2,4-5,7-10,12,25H,3,6,11H2,(H,21,22,23) |
| InChIKey | ANFNRTDGVXSZPC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |