C19H15ClN4O — CID 109314479
[2-(3-chloroanilino)pyrimidin-4-yl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 109314479) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is [2-(3-chloroanilino)pyrimidin-4-yl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [2-(3-chloroanilino)pyrimidin-4-yl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 109314479 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-(3-chloroanilino)pyrimidin-4-yl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccnc(Nc2cccc(Cl)c2)n1)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H15ClN4O/c20-14-5-3-6-15(12-14)22-19-21-10-8-16(23-19)18(25)24-11-9-13-4-1-2-7-17(13)24/h1-8,10,12H,9,11H2,(H,21,22,23) |
| InChIKey | RVIKOMUHARFFEI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |