C20H15F3N4O — CID 109314677
3,4-dihydro-2H-quinolin-1-yl-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone (PubChem CID 109314677) has the molecular formula C20H15F3N4O and a molecular weight of 384.36 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109314677 |
| Molecular Formula | C20H15F3N4O |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone |
| SMILES | O=C(c1ccnc(Nc2ccc(F)c(F)c2F)n1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H15F3N4O/c21-13-7-8-14(18(23)17(13)22)25-20-24-10-9-15(26-20)19(28)27-11-3-5-12-4-1-2-6-16(12)27/h1-2,4,6-10H,3,5,11H2,(H,24,25,26) |
| InChIKey | GKUVLQOKCJTWCY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|