C16H16F3N5O — CID 109302365
(4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone (PubChem CID 109302365) has the molecular formula C16H16F3N5O and a molecular weight of 351.33 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109302365 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone |
| SMILES | CN1CCN(C(=O)c2ccnc(Nc3ccc(F)c(F)c3F)n2)CC1 |
| InChI | InChI=1S/C16H16F3N5O/c1-23-6-8-24(9-7-23)15(25)12-4-5-20-16(22-12)21-11-3-2-10(17)13(18)14(11)19/h2-5H,6-9H2,1H3,(H,20,21,22) |
| InChIKey | QPOMLAOWPSMLCS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|