C17H17F3N4O — CID 109168549
(4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)-4-pyridinyl]methanone (PubChem CID 109168549) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)-4-pyridinyl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 109168549 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[2-(2,3,4-trifluoroanilino)-4-pyridinyl]methanone |
| SMILES | CN1CCN(C(=O)c2ccnc(Nc3ccc(F)c(F)c3F)c2)CC1 |
| InChI | InChI=1S/C17H17F3N4O/c1-23-6-8-24(9-7-23)17(25)11-4-5-21-14(10-11)22-13-3-2-12(18)15(19)16(13)20/h2-5,10H,6-9H2,1H3,(H,21,22) |
| InChIKey | ITHBSUZBQLBGGW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|