C19H28N4O — CID 70744470
[2-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]amino]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 70744470) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is [2-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]amino]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [2-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]amino]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 70744470 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | [2-[[(1S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]amino]-4-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccnc(N[C@H]3CC[C@@H]4CCC[C@@H]43)c2)CC1 |
| InChI | InChI=1S/C19H28N4O/c1-22-9-11-23(12-10-22)19(24)15-7-8-20-18(13-15)21-17-6-5-14-3-2-4-16(14)17/h7-8,13-14,16-17H,2-6,9-12H2,1H3,(H,20,21)/t14-,16-,17-/m0/s1 |
| InChIKey | YESHYNCMHYUYDT-XIRDDKMYSA-N |
| XLogP | 2.46 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |