C16H18BrN5O — CID 109302335
[2-(2-bromoanilino)pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 109302335) has the molecular formula C16H18BrN5O and a molecular weight of 376.26 g/mol. Its IUPAC name is [2-(2-bromoanilino)pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [2-(2-bromoanilino)pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109302335 |
| Molecular Formula | C16H18BrN5O |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [2-(2-bromoanilino)pyrimidin-4-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccnc(Nc3ccccc3Br)n2)CC1 |
| InChI | InChI=1S/C16H18BrN5O/c1-21-8-10-22(11-9-21)15(23)14-6-7-18-16(20-14)19-13-5-3-2-4-12(13)17/h2-7H,8-11H2,1H3,(H,18,19,20) |
| InChIKey | MSHGUAYWVXYKGM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |