C16H24N8 — CID 112958107
N-pentyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine (PubChem CID 112958107) has the molecular formula C16H24N8 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-pentyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine.
| Compound Name | N-pentyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112958107 |
| Molecular Formula | C16H24N8 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | N-pentyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,4-triazin-5-amine |
| SMILES | CCCCCNc1cnnc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C16H24N8/c1-2-3-4-6-17-14-13-20-22-16(21-14)24-11-9-23(10-12-24)15-18-7-5-8-19-15/h5,7-8,13H,2-4,6,9-12H2,1H3,(H,17,21,22) |
| InChIKey | UNQQLZSZXCHCDH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|