C8H13ClN4 — CID 114999369
3-chloro-N-pentyl-1,2,4-triazin-5-amine (PubChem CID 114999369) has the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. Its IUPAC name is 3-chloro-N-pentyl-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-pentyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 114999369 |
| Molecular Formula | C8H13ClN4 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-chloro-N-pentyl-1,2,4-triazin-5-amine |
| SMILES | CCCCCNc1cnnc(Cl)n1 |
| InChI | InChI=1S/C8H13ClN4/c1-2-3-4-5-10-7-6-11-13-8(9)12-7/h6H,2-5H2,1H3,(H,10,12,13) |
| InChIKey | USMPXQKDOLGURY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|