C12H23N5 — CID 112940921
3-N-butan-2-yl-5-N-pentyl-1,2,4-triazine-3,5-diamine (PubChem CID 112940921) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-N-butan-2-yl-5-N-pentyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-butan-2-yl-5-N-pentyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112940921 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 3-N-butan-2-yl-5-N-pentyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCCNc1cnnc(NC(C)CC)n1 |
| InChI | InChI=1S/C12H23N5/c1-4-6-7-8-13-11-9-14-17-12(16-11)15-10(3)5-2/h9-10H,4-8H2,1-3H3,(H2,13,15,16,17) |
| InChIKey | PBNSYNQDFYAKNY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|