C8H9ClN6 — CID 114999031
3-chloro-N-(2-pyrazol-1-ylethyl)-1,2,4-triazin-5-amine (PubChem CID 114999031) has the molecular formula C8H9ClN6 and a molecular weight of 224.66 g/mol. Its IUPAC name is 3-chloro-N-(2-pyrazol-1-ylethyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-(2-pyrazol-1-ylethyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 114999031 |
| Molecular Formula | C8H9ClN6 |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-chloro-N-(2-pyrazol-1-ylethyl)-1,2,4-triazin-5-amine |
| SMILES | Clc1nncc(NCCn2cccn2)n1 |
| InChI | InChI=1S/C8H9ClN6/c9-8-13-7(6-11-14-8)10-3-5-15-4-1-2-12-15/h1-2,4,6H,3,5H2,(H,10,13,14) |
| InChIKey | MGZVZSLJPCPTTN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |