C13H12ClN5S — CID 58985537
2-chloro-N-(2-pyrazol-1-ylethyl)-5-thiophen-2-ylpyrimidin-4-amine (PubChem CID 58985537) has the molecular formula C13H12ClN5S and a molecular weight of 305.79 g/mol. Its IUPAC name is 2-chloro-N-(2-pyrazol-1-ylethyl)-5-thiophen-2-ylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2-pyrazol-1-ylethyl)-5-thiophen-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 58985537 |
| Molecular Formula | C13H12ClN5S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-chloro-N-(2-pyrazol-1-ylethyl)-5-thiophen-2-ylpyrimidin-4-amine |
| SMILES | Clc1ncc(-c2cccs2)c(NCCn2cccn2)n1 |
| InChI | InChI=1S/C13H12ClN5S/c14-13-16-9-10(11-3-1-8-20-11)12(18-13)15-5-7-19-6-2-4-17-19/h1-4,6,8-9H,5,7H2,(H,15,16,18) |
| InChIKey | CTJUJIVZOZXLTF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |