C7H11ClN4O — CID 114999418
3-chloro-N-(3-methoxypropyl)-1,2,4-triazin-5-amine (PubChem CID 114999418) has the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. Its IUPAC name is 3-chloro-N-(3-methoxypropyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-(3-methoxypropyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 114999418 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-chloro-N-(3-methoxypropyl)-1,2,4-triazin-5-amine |
| SMILES | COCCCNc1cnnc(Cl)n1 |
| InChI | InChI=1S/C7H11ClN4O/c1-13-4-2-3-9-6-5-10-12-7(8)11-6/h5H,2-4H2,1H3,(H,9,11,12) |
| InChIKey | ZBTLCYJXFBKMRX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|