C20H22ClN5O2 — CID 112943828
3-N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112943828) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 3-N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943828 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COCCCNc1cnnc(Nc2ccc(OCc3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C20H22ClN5O2/c1-27-12-2-11-22-19-13-23-26-20(25-19)24-17-7-9-18(10-8-17)28-14-15-3-5-16(21)6-4-15/h3-10,13H,2,11-12,14H2,1H3,(H2,22,24,25,26) |
| InChIKey | CFJNELGUTOVACG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|