C14H15ClF3N5O — CID 112943826
3-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112943826) has the molecular formula C14H15ClF3N5O and a molecular weight of 361.76 g/mol. Its IUPAC name is 3-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943826 |
| Molecular Formula | C14H15ClF3N5O |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COCCCNc1cnnc(Nc2ccc(Cl)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H15ClF3N5O/c1-24-6-2-5-19-12-8-20-23-13(22-12)21-9-3-4-11(15)10(7-9)14(16,17)18/h3-4,7-8H,2,5-6H2,1H3,(H2,19,21,22,23) |
| InChIKey | OPDODHHAVSSUFQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|