C14H19N5O2 — CID 112943964
5-N-(4-methoxyphenyl)-3-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112943964) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-N-(4-methoxyphenyl)-3-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(4-methoxyphenyl)-3-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943964 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 5-N-(4-methoxyphenyl)-3-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COCCCNc1nncc(Nc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C14H19N5O2/c1-20-9-3-8-15-14-18-13(10-16-19-14)17-11-4-6-12(21-2)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H2,15,17,18,19) |
| InChIKey | LBAGFTHDTTWAPM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|