C6H7ClN4O2 — CID 114999415
methyl 2-[(3-chloro-1,2,4-triazin-5-yl)amino]acetate (PubChem CID 114999415) has the molecular formula C6H7ClN4O2 and a molecular weight of 202.60 g/mol. Its IUPAC name is methyl 2-[(3-chloro-1,2,4-triazin-5-yl)amino]acetate.
| Compound Name | methyl 2-[(3-chloro-1,2,4-triazin-5-yl)amino]acetate |
|---|---|
| PubChem CID | 114999415 |
| Molecular Formula | C6H7ClN4O2 |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | methyl 2-[(3-chloro-1,2,4-triazin-5-yl)amino]acetate |
| SMILES | COC(=O)CNc1cnnc(Cl)n1 |
| InChI | InChI=1S/C6H7ClN4O2/c1-13-5(12)3-8-4-2-9-11-6(7)10-4/h2H,3H2,1H3,(H,8,10,11) |
| InChIKey | COZSZHPNUXMYQQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |