C9H9Cl2NO2 — CID 28576225
methyl 2-(3,5-dichloroanilino)acetate (PubChem CID 28576225) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is methyl 2-(3,5-dichloroanilino)acetate.
| Compound Name | methyl 2-(3,5-dichloroanilino)acetate |
|---|---|
| PubChem CID | 28576225 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | methyl 2-(3,5-dichloroanilino)acetate |
| SMILES | COC(=O)CNc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NO2/c1-14-9(13)5-12-8-3-6(10)2-7(11)4-8/h2-4,12H,5H2,1H3 |
| InChIKey | FSAANGDKOPJKMR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |