C13H17Cl2N3O — CID 28515284
2-(3,5-dichloroanilino)-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 28515284) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3,5-dichloroanilino)-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 28515284 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(3,5-dichloroanilino)-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CNc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17Cl2N3O/c1-17-2-4-18(5-3-17)13(19)9-16-12-7-10(14)6-11(15)8-12/h6-8,16H,2-5,9H2,1H3 |
| InChIKey | QJUNEAUWVIEYQR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |