C14H20ClN3O2 — CID 28570686
2-(3-chloro-4-methoxyanilino)-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 28570686) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 28570686 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc(NCC(=O)N2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C14H20ClN3O2/c1-17-5-7-18(8-6-17)14(19)10-16-11-3-4-13(20-2)12(15)9-11/h3-4,9,16H,5-8,10H2,1-2H3 |
| InChIKey | XBIKBMSCDXBKTA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|