C10H13N3O2S — CID 114767112
methyl 2-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]acetate (PubChem CID 114767112) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is methyl 2-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]acetate.
| Compound Name | methyl 2-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 114767112 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | methyl 2-[(4-carbamothioyl-6-methyl-2-pyridinyl)amino]acetate |
| SMILES | COC(=O)CNc1cc(C(N)=S)cc(C)n1 |
| InChI | InChI=1S/C10H13N3O2S/c1-6-3-7(10(11)16)4-8(13-6)12-5-9(14)15-2/h3-4H,5H2,1-2H3,(H2,11,16)(H,12,13) |
| InChIKey | JMRGYKPSZPFYQR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|