C8H13N5O2 — CID 80944792
methyl 2-[(2-hydrazinyl-6-methylpyrimidin-4-yl)amino]acetate (PubChem CID 80944792) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 2-[(2-hydrazinyl-6-methylpyrimidin-4-yl)amino]acetate.
| Compound Name | methyl 2-[(2-hydrazinyl-6-methylpyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 80944792 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | methyl 2-[(2-hydrazinyl-6-methylpyrimidin-4-yl)amino]acetate |
| SMILES | COC(=O)CNc1cc(C)nc(NN)n1 |
| InChI | InChI=1S/C8H13N5O2/c1-5-3-6(10-4-7(14)15-2)12-8(11-5)13-9/h3H,4,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | XZIRFZDNZVXWGT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|