C17H24N6O — CID 112943516
5-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-1,2,4-triazin-3-amine (PubChem CID 112943516) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112943516 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 5-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-1,2,4-triazin-3-amine |
| SMILES | COCCNc1nncc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H24N6O/c1-24-12-7-18-17-20-16(13-19-21-17)23-10-8-22(9-11-23)14-15-5-3-2-4-6-15/h2-6,13H,7-12,14H2,1H3,(H,18,20,21) |
| InChIKey | JPZSLHPBPWBTEW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|