C37H60N6O5 — CID 167675929
methanol;2-methoxy-4-[4-(4-methylpiperazin-1-yl)cyclohexyl]aniline;1-[4-(3-methoxy-4-nitrophenyl)cyclohexyl]-4-methylpiperazine (PubChem CID 167675929) has the molecular formula C37H60N6O5 and a molecular weight of 668.92 g/mol. Its IUPAC name is methanol;2-methoxy-4-[4-(4-methylpiperazin-1-yl)cyclohexyl]aniline;1-[4-(3-methoxy-4-nitrophenyl)cyclohexyl]-4-methylpiperazine.
| Compound Name | methanol;2-methoxy-4-[4-(4-methylpiperazin-1-yl)cyclohexyl]aniline;1-[4-(3-methoxy-4-nitrophenyl)cyclohexyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 167675929 |
| Molecular Formula | C37H60N6O5 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.46 |
| IUPAC Name | methanol;2-methoxy-4-[4-(4-methylpiperazin-1-yl)cyclohexyl]aniline;1-[4-(3-methoxy-4-nitrophenyl)cyclohexyl]-4-methylpiperazine |
| SMILES | CO.COc1cc(C2CCC(N3CCN(C)CC3)CC2)ccc1N.COc1cc(C2CCC(N3CCN(C)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H27N3O3.C18H29N3O.CH4O/c1-19-9-11-20(12-10-19)16-6-3-14(4-7-16)15-5-8-17(21(22)23)18(13-15)24-2;1-20-9-11-21(12-10-20)16-6-3-14(4-7-16)15-5-8-17(19)18(13-15)22-2;1-2/h5,8,13-14,16H,3-4,6-7,9-12H2,1-2H3;5,8,13-14,16H,3-4,6-7,9-12,19H2,1-2H3;2H,1H3 |
| InChIKey | UUUHLQIXXPRRLE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|