C26H40N6O2 — CID 159183321
1-(4-aminophenyl)-N,N-dimethylpiperidin-4-amine;N,N-dimethyl-1-(4-nitrophenyl)piperidin-4-amine (PubChem CID 159183321) has the molecular formula C26H40N6O2 and a molecular weight of 468.65 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N,N-dimethylpiperidin-4-amine;N,N-dimethyl-1-(4-nitrophenyl)piperidin-4-amine.
| Compound Name | 1-(4-aminophenyl)-N,N-dimethylpiperidin-4-amine;N,N-dimethyl-1-(4-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 159183321 |
| Molecular Formula | C26H40N6O2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 1-(4-aminophenyl)-N,N-dimethylpiperidin-4-amine;N,N-dimethyl-1-(4-nitrophenyl)piperidin-4-amine |
| SMILES | CN(C)C1CCN(c2ccc(N)cc2)CC1.CN(C)C1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C13H19N3O2.C13H21N3/c1-14(2)11-7-9-15(10-8-11)12-3-5-13(6-4-12)16(17)18;1-15(2)12-7-9-16(10-8-12)13-5-3-11(14)4-6-13/h3-6,11H,7-10H2,1-2H3;3-6,12H,7-10,14H2,1-2H3 |
| InChIKey | KNEDYBPCBQPLPY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|